About 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole
9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole (PubChem CID 66766093) has the molecular formula C25H17ClN2O2S
and a molecular weight of 444.94 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole |
| PubChem CID | 66766093 |
| Molecular Formula | C25H17ClN2O2S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole |
| SMILES | C=C(c1ccccc1)c1ccc2c(c1)c1c(Cl)ccnc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H17ClN2O2S/c1-17(18-8-4-2-5-9-18)19-12-13-23-21(16-19)24-22(26)14-15-27-25(24)28(23)31(29,30)20-10-6-3-7-11-20/h2-16H,1H2 |
| InChIKey | ZIQIIWQOFPSTFQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole (CID 66766093) is 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole is C=C(c1ccccc1)c1ccc2c(c1)c1c(Cl)ccnc1n2S(=O)(=O)c1ccccc1.
What is the InChIKey of 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole?
The InChIKey is ZIQIIWQOFPSTFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17ClN2O2S/c1-17(18-8-4-2-5-9-18)19-12-13-23-21(16-19)24-22(26)14-15-27-25(24)28(23)31(29,30)20-10-6-3-7-11-20/h2-16H,1H2.
What are the key properties of 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole?
9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole has a molecular weight of 444.94 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-4-chloro-6-(1-phenylethenyl)pyrido[2,3-b]indole is sourced from PubChem (CID 66766093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).