About 2-aminoguanidine;1H-indole
2-aminoguanidine;1H-indole (PubChem CID 66766557) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is 2-aminoguanidine;1H-indole.
Molecular Properties
| Compound Name | 2-aminoguanidine;1H-indole |
| PubChem CID | 66766557 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-aminoguanidine;1H-indole |
| SMILES | NN=C(N)N.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.CH6N4/c1-2-4-8-7(3-1)5-6-9-8;2-1(3)5-4/h1-6,9H;4H2,(H4,2,3,5) |
| InChIKey | NOJJSLNDNQBLFF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoguanidine;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoguanidine;1H-indole?
The IUPAC name of 2-aminoguanidine;1H-indole (CID 66766557) is 2-aminoguanidine;1H-indole.
What is the SMILES notation for 2-aminoguanidine;1H-indole?
The canonical SMILES for 2-aminoguanidine;1H-indole is NN=C(N)N.c1ccc2[nH]ccc2c1.
What is the InChIKey of 2-aminoguanidine;1H-indole?
The InChIKey is NOJJSLNDNQBLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.CH6N4/c1-2-4-8-7(3-1)5-6-9-8;2-1(3)5-4/h1-6,9H;4H2,(H4,2,3,5).
What are the key properties of 2-aminoguanidine;1H-indole?
2-aminoguanidine;1H-indole has a molecular weight of 191.24 g/mol, XLogP of 0.30, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoguanidine;1H-indole is sourced from PubChem (CID 66766557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).