About 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline
4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline (PubChem CID 66767155) has the molecular formula C20H17FN4O
and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline.
Molecular Properties
| Compound Name | 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline |
| PubChem CID | 66767155 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline |
| SMILES | Cc1cc(-c2cc3[nH]ncc3cc2Oc2ccc(N)cc2F)cc(C)n1 |
| InChI | InChI=1S/C20H17FN4O/c1-11-5-13(6-12(2)24-11)16-9-18-14(10-23-25-18)7-20(16)26-19-4-3-15(22)8-17(19)21/h3-10H,22H2,1-2H3,(H,23,25) |
| InChIKey | WBOBUZFGMWDEPU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline?
The IUPAC name of 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline (CID 66767155) is 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline.
What is the SMILES notation for 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline?
The canonical SMILES for 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline is Cc1cc(-c2cc3[nH]ncc3cc2Oc2ccc(N)cc2F)cc(C)n1.
What is the InChIKey of 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline?
The InChIKey is WBOBUZFGMWDEPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN4O/c1-11-5-13(6-12(2)24-11)16-9-18-14(10-23-25-18)7-20(16)26-19-4-3-15(22)8-17(19)21/h3-10H,22H2,1-2H3,(H,23,25).
What are the key properties of 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline?
4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline has a molecular weight of 348.38 g/mol, XLogP of 4.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(2,6-dimethyl-4-pyridinyl)-1H-indazol-5-yl]oxy]-3-fluoroaniline is sourced from PubChem (CID 66767155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).