C15H15NO5S — CID 66767279
4-(4-methoxyphenoxy)-N-methylsulfonylbenzamide (PubChem CID 66767279) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-methylsulfonylbenzamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 66767279 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-methylsulfonylbenzamide |
| SMILES | COc1ccc(Oc2ccc(C(=O)NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H15NO5S/c1-20-12-7-9-14(10-8-12)21-13-5-3-11(4-6-13)15(17)16-22(2,18)19/h3-10H,1-2H3,(H,16,17) |
| InChIKey | RJCIQOVTPWSTBH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |