About 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine
3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine (PubChem CID 66767957) has the molecular formula C12H14N6S
and a molecular weight of 274.35 g/mol. Its IUPAC name is 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine |
| PubChem CID | 66767957 |
| Molecular Formula | C12H14N6S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine |
| SMILES | NCCNc1n[nH]c(N)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N6S/c13-5-6-15-11-9(10(14)17-18-11)12-16-7-3-1-2-4-8(7)19-12/h1-4H,5-6,13H2,(H4,14,15,17,18) |
| InChIKey | DQNQLZBDDJZWCD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
The IUPAC name of 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine (CID 66767957) is 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
The canonical SMILES for 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine is NCCNc1n[nH]c(N)c1-c1nc2ccccc2s1.
What is the InChIKey of 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
The InChIKey is DQNQLZBDDJZWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6S/c13-5-6-15-11-9(10(14)17-18-11)12-16-7-3-1-2-4-8(7)19-12/h1-4H,5-6,13H2,(H4,14,15,17,18).
What are the key properties of 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine has a molecular weight of 274.35 g/mol, XLogP of 1.64, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2-aminoethyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 66767957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).