C14H18N6S — CID 66768004
4-(1,3-benzothiazol-2-yl)-3-N-[2-(ethylamino)ethyl]-1H-pyrazole-3,5-diamine (PubChem CID 66768004) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-N-[2-(ethylamino)ethyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-N-[2-(ethylamino)ethyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 66768004 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-N-[2-(ethylamino)ethyl]-1H-pyrazole-3,5-diamine |
| SMILES | CCNCCNc1n[nH]c(N)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18N6S/c1-2-16-7-8-17-13-11(12(15)19-20-13)14-18-9-5-3-4-6-10(9)21-14/h3-6,16H,2,7-8H2,1H3,(H4,15,17,19,20) |
| InChIKey | LPPNBRYRNAIQJJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|