C15H20N6S — CID 66768023
4-(1,3-benzothiazol-2-yl)-3-N-[3-(dimethylamino)propyl]-1H-pyrazole-3,5-diamine (PubChem CID 66768023) has the molecular formula C15H20N6S and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-N-[3-(dimethylamino)propyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-N-[3-(dimethylamino)propyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 66768023 |
| Molecular Formula | C15H20N6S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-N-[3-(dimethylamino)propyl]-1H-pyrazole-3,5-diamine |
| SMILES | CN(C)CCCNc1n[nH]c(N)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H20N6S/c1-21(2)9-5-8-17-14-12(13(16)19-20-14)15-18-10-6-3-4-7-11(10)22-15/h3-4,6-7H,5,8-9H2,1-2H3,(H4,16,17,19,20) |
| InChIKey | JDXRQOFYLUYCEK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|