About 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine
4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine (PubChem CID 66768108) has the molecular formula C14H16N6S
and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine |
| PubChem CID | 66768108 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]nc(N2CCNCC2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H16N6S/c15-12-11(13(19-18-12)20-7-5-16-6-8-20)14-17-9-3-1-2-4-10(9)21-14/h1-4,16H,5-8H2,(H3,15,18,19) |
| InChIKey | FIJKJYNYFHYOLF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine (CID 66768108) is 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine is Nc1[nH]nc(N2CCNCC2)c1-c1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine?
The InChIKey is FIJKJYNYFHYOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6S/c15-12-11(13(19-18-12)20-7-5-16-6-8-20)14-17-9-3-1-2-4-10(9)21-14/h1-4,16H,5-8H2,(H3,15,18,19).
What are the key properties of 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine?
4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine has a molecular weight of 300.39 g/mol, XLogP of 1.68, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)-3-piperazin-1-yl-1H-pyrazol-5-amine is sourced from PubChem (CID 66768108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).