About 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide
4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide (PubChem CID 66768118) has the molecular formula C23H17Cl2N5O2
and a molecular weight of 466.33 g/mol. Its IUPAC name is 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide.
Molecular Properties
| Compound Name | 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide |
| PubChem CID | 66768118 |
| Molecular Formula | C23H17Cl2N5O2 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide |
| SMILES | NC(=O)c1cccc2c(NCc3cccc(NC(=O)c4ccc(Cl)c(Cl)c4)c3)ncnc12 |
| InChI | InChI=1S/C23H17Cl2N5O2/c24-18-8-7-14(10-19(18)25)23(32)30-15-4-1-3-13(9-15)11-27-22-17-6-2-5-16(21(26)31)20(17)28-12-29-22/h1-10,12H,11H2,(H2,26,31)(H,30,32)(H,27,28,29) |
| InChIKey | VSIZGIFPGSTFOV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide?
The IUPAC name of 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide (CID 66768118) is 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide.
What is the SMILES notation for 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide?
The canonical SMILES for 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide is NC(=O)c1cccc2c(NCc3cccc(NC(=O)c4ccc(Cl)c(Cl)c4)c3)ncnc12.
What is the InChIKey of 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide?
The InChIKey is VSIZGIFPGSTFOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17Cl2N5O2/c24-18-8-7-14(10-19(18)25)23(32)30-15-4-1-3-13(9-15)11-27-22-17-6-2-5-16(21(26)31)20(17)28-12-29-22/h1-10,12H,11H2,(H2,26,31)(H,30,32)(H,27,28,29).
What are the key properties of 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide?
4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide has a molecular weight of 466.33 g/mol, XLogP of 4.90, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[(3,4-dichlorobenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide is sourced from PubChem (CID 66768118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).