About 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine
4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine (PubChem CID 66768227) has the molecular formula C19H14N6S
and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine |
| PubChem CID | 66768227 |
| Molecular Formula | C19H14N6S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine |
| SMILES | Nc1[nH]nc(Nc2ccc3ncccc3c2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14N6S/c20-17-16(19-23-14-5-1-2-6-15(14)26-19)18(25-24-17)22-12-7-8-13-11(10-12)4-3-9-21-13/h1-10H,(H4,20,22,24,25) |
| InChIKey | MQTCPUCKVUOTPF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine (CID 66768227) is 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine is Nc1[nH]nc(Nc2ccc3ncccc3c2)c1-c1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine?
The InChIKey is MQTCPUCKVUOTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N6S/c20-17-16(19-23-14-5-1-2-6-15(14)26-19)18(25-24-17)22-12-7-8-13-11(10-12)4-3-9-21-13/h1-10H,(H4,20,22,24,25).
What are the key properties of 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine?
4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine has a molecular weight of 358.43 g/mol, XLogP of 4.56, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-6-yl-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 66768227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).