C25H24F3N5O4 — CID 66768356
benzyl-[(2S,3S)-3-hydroxy-2-[[2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetyl]amino]hex-4-ynyl]carbamic acid (PubChem CID 66768356) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is benzyl-[(2S,3S)-3-hydroxy-2-[[2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetyl]amino]hex-4-ynyl]carbamic acid.
| Compound Name | benzyl-[(2S,3S)-3-hydroxy-2-[[2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetyl]amino]hex-4-ynyl]carbamic acid |
|---|---|
| PubChem CID | 66768356 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | benzyl-[(2S,3S)-3-hydroxy-2-[[2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetyl]amino]hex-4-ynyl]carbamic acid |
| SMILES | CC#C[C@H](O)[C@H](CN(Cc1ccccc1)C(=O)O)NC(=O)CNc1ncnc2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C25H24F3N5O4/c1-2-6-21(34)20(14-33(24(36)37)13-16-7-4-3-5-8-16)32-22(35)12-29-23-18-11-17(25(26,27)28)9-10-19(18)30-15-31-23/h3-5,7-11,15,20-21,34H,12-14H2,1H3,(H,32,35)(H,36,37)(H,29,30,31)/t20-,21-/m0/s1 |
| InChIKey | ORVKHHPIWTXSGL-SFTDATJTSA-N |
| XLogP | 3.11 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|