About [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate
[2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate (PubChem CID 66768513) has the molecular formula C14H14N4O3S
and a molecular weight of 318.36 g/mol. Its IUPAC name is [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate |
| PubChem CID | 66768513 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2sc(-c3c(N)n[nH]c3C)nc2c1 |
| InChI | InChI=1S/C14H14N4O3S/c1-3-20-14(19)21-8-4-5-10-9(6-8)16-13(22-10)11-7(2)17-18-12(11)15/h4-6H,3H2,1-2H3,(H3,15,17,18) |
| InChIKey | KKVJUNOQPSJHRQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate?
The IUPAC name of [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate (CID 66768513) is [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate.
What is the SMILES notation for [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate?
The canonical SMILES for [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate is CCOC(=O)Oc1ccc2sc(-c3c(N)n[nH]c3C)nc2c1.
What is the InChIKey of [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate?
The InChIKey is KKVJUNOQPSJHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O3S/c1-3-20-14(19)21-8-4-5-10-9(6-8)16-13(22-10)11-7(2)17-18-12(11)15/h4-6H,3H2,1-2H3,(H3,15,17,18).
What are the key properties of [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate?
[2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate has a molecular weight of 318.36 g/mol, XLogP of 3.11, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-amino-5-methyl-1H-pyrazol-4-yl)-1,3-benzothiazol-5-yl] ethyl carbonate is sourced from PubChem (CID 66768513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).