About 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid
2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid (PubChem CID 66769139) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid |
| PubChem CID | 66769139 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C7H10N2O3/c1-2-4(7(11)12)5-3-6(10)9-8-5/h3-4H,2H2,1H3,(H,11,12)(H2,8,9,10) |
| InChIKey | KMZIFGJJEHCJPG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid?
The IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid (CID 66769139) is 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid.
What is the SMILES notation for 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid?
The canonical SMILES for 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid is CCC(C(=O)O)c1cc(=O)[nH][nH]1.
What is the InChIKey of 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid?
The InChIKey is KMZIFGJJEHCJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-2-4(7(11)12)5-3-6(10)9-8-5/h3-4H,2H2,1H3,(H,11,12)(H2,8,9,10).
What are the key properties of 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid?
2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid has a molecular weight of 170.17 g/mol, XLogP of 0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1,2-dihydropyrazol-3-yl)butanoic acid is sourced from PubChem (CID 66769139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).