About [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride
[3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride (PubChem CID 66769156) has the molecular formula C12H17ClN4O
and a molecular weight of 268.75 g/mol. Its IUPAC name is [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride |
| PubChem CID | 66769156 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cccc(OCCCn2cncn2)c1 |
| InChI | InChI=1S/C12H16N4O.ClH/c13-8-11-3-1-4-12(7-11)17-6-2-5-16-10-14-9-15-16;/h1,3-4,7,9-10H,2,5-6,8,13H2;1H |
| InChIKey | QCTXZNCZSCLFDL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride?
The IUPAC name of [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride (CID 66769156) is [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride.
What is the SMILES notation for [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride?
The canonical SMILES for [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride is Cl.NCc1cccc(OCCCn2cncn2)c1.
What is the InChIKey of [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride?
The InChIKey is QCTXZNCZSCLFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O.ClH/c13-8-11-3-1-4-12(7-11)17-6-2-5-16-10-14-9-15-16;/h1,3-4,7,9-10H,2,5-6,8,13H2;1H.
What are the key properties of [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride?
[3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride has a molecular weight of 268.75 g/mol, XLogP of 1.63, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methanamine;hydrochloride is sourced from PubChem (CID 66769156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).