About 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride
2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride (PubChem CID 66769369) has the molecular formula C4H5Cl2N3S
and a molecular weight of 198.08 g/mol. Its IUPAC name is 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride |
| PubChem CID | 66769369 |
| Molecular Formula | C4H5Cl2N3S |
| Molecular Weight | 198.08 g/mol |
| Exact Mass | 196.96 |
| IUPAC Name | 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1csc(Cl)n1 |
| InChI | InChI=1S/C4H4ClN3S.ClH/c5-4-8-2(1-9-4)3(6)7;/h1H,(H3,6,7);1H |
| InChIKey | HUKRYSDXWMUWNH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.08 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride?
The IUPAC name of 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride (CID 66769369) is 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride.
What is the SMILES notation for 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride?
The canonical SMILES for 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)c1csc(Cl)n1.
What is the InChIKey of 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride?
The InChIKey is HUKRYSDXWMUWNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClN3S.ClH/c5-4-8-2(1-9-4)3(6)7;/h1H,(H3,6,7);1H.
What are the key properties of 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride?
2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride has a molecular weight of 198.08 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-thiazole-4-carboximidamide;hydrochloride is sourced from PubChem (CID 66769369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).