C15H22ClN3 — CID 66769814
9-chloro-7-ethyl-3-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,5]benzodiazepine (PubChem CID 66769814) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 9-chloro-7-ethyl-3-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,5]benzodiazepine.
| Compound Name | 9-chloro-7-ethyl-3-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,5]benzodiazepine |
|---|---|
| PubChem CID | 66769814 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 9-chloro-7-ethyl-3-methyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,5]benzodiazepine |
| SMILES | CCN1CCC2CN(C)CCN2c2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H22ClN3/c1-3-18-7-6-13-11-17(2)8-9-19(13)14-5-4-12(16)10-15(14)18/h4-5,10,13H,3,6-9,11H2,1-2H3 |
| InChIKey | IDDPCPNMEITPJO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |