About 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol
2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol (PubChem CID 66769968) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol |
| PubChem CID | 66769968 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol |
| SMILES | COc1nn(CCO)c(N)c1N |
| InChI | InChI=1S/C6H12N4O2/c1-12-6-4(7)5(8)10(9-6)2-3-11/h11H,2-3,7-8H2,1H3 |
| InChIKey | SGRCTXYUYLTZCV-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol?
The IUPAC name of 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol (CID 66769968) is 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol.
What is the SMILES notation for 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol?
The canonical SMILES for 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol is COc1nn(CCO)c(N)c1N.
What is the InChIKey of 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol?
The InChIKey is SGRCTXYUYLTZCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2/c1-12-6-4(7)5(8)10(9-6)2-3-11/h11H,2-3,7-8H2,1H3.
What are the key properties of 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol?
2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol has a molecular weight of 172.19 g/mol, XLogP of -0.95, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-diamino-3-methoxypyrazol-1-yl)ethanol is sourced from PubChem (CID 66769968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).