C9H4N4O — CID 66769975
4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,6,8,10,12-hexaen-5-one (PubChem CID 66769975) has the molecular formula C9H4N4O and a molecular weight of 184.16 g/mol. Its IUPAC name is 4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,6,8,10,12-hexaen-5-one.
| Compound Name | 4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,6,8,10,12-hexaen-5-one |
|---|---|
| PubChem CID | 66769975 |
| Molecular Formula | C9H4N4O |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,6,8,10,12-hexaen-5-one |
| SMILES | O=C1N=CC2=c3cccnc3=NC2=N1 |
| InChI | InChI=1S/C9H4N4O/c14-9-11-4-6-5-2-1-3-10-7(5)12-8(6)13-9/h1-4H |
| InChIKey | OKIBJZYRXJEDEE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 67.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |