C19H22N4O — CID 66770200
9-amino-3-benzyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,4]benzodiazepin-7-one (PubChem CID 66770200) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 9-amino-3-benzyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,4]benzodiazepin-7-one.
| Compound Name | 9-amino-3-benzyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 66770200 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 9-amino-3-benzyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a][1,4]benzodiazepin-7-one |
| SMILES | Nc1ccc2c(c1)C(=O)NCC1CN(Cc3ccccc3)CCN21 |
| InChI | InChI=1S/C19H22N4O/c20-15-6-7-18-17(10-15)19(24)21-11-16-13-22(8-9-23(16)18)12-14-4-2-1-3-5-14/h1-7,10,16H,8-9,11-13,20H2,(H,21,24) |
| InChIKey | FPPNFKQIPVSEEI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|