C28H36F2N6O4SSi — CID 66770390
4-[[5-(2,6-difluorophenyl)-7-(hydroxymethyl)-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-yl]amino]piperidine-1-sulfonamide (PubChem CID 66770390) has the molecular formula C28H36F2N6O4SSi and a molecular weight of 618.78 g/mol. Its IUPAC name is 4-[[5-(2,6-difluorophenyl)-7-(hydroxymethyl)-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-yl]amino]piperidine-1-sulfonamide.
| Compound Name | 4-[[5-(2,6-difluorophenyl)-7-(hydroxymethyl)-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-yl]amino]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 66770390 |
| Molecular Formula | C28H36F2N6O4SSi |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | 4-[[5-(2,6-difluorophenyl)-7-(hydroxymethyl)-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-yl]amino]piperidine-1-sulfonamide |
| SMILES | C[Si](C)(C)CCOCn1nc2c(nc(-c3c(F)cccc3F)c3cc(CO)ccc32)c1NC1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C28H36F2N6O4SSi/c1-42(2,3)14-13-40-17-36-28(32-19-9-11-35(12-10-19)41(31,38)39)27-26(34-36)20-8-7-18(16-37)15-21(20)25(33-27)24-22(29)5-4-6-23(24)30/h4-8,15,19,32,37H,9-14,16-17H2,1-3H3,(H2,31,38,39) |
| InChIKey | MWBVIUHZBARMIQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|