C27H32F3N5OSi — CID 66770470
5-(2,6-difluorophenyl)-7-fluoro-N-piperidin-4-yl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-amine (PubChem CID 66770470) has the molecular formula C27H32F3N5OSi and a molecular weight of 527.67 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-7-fluoro-N-piperidin-4-yl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-amine.
| Compound Name | 5-(2,6-difluorophenyl)-7-fluoro-N-piperidin-4-yl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-amine |
|---|---|
| PubChem CID | 66770470 |
| Molecular Formula | C27H32F3N5OSi |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 5-(2,6-difluorophenyl)-7-fluoro-N-piperidin-4-yl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]isoquinolin-3-amine |
| SMILES | C[Si](C)(C)CCOCn1nc2c(nc(-c3c(F)cccc3F)c3cc(F)ccc32)c1NC1CCNCC1 |
| InChI | InChI=1S/C27H32F3N5OSi/c1-37(2,3)14-13-36-16-35-27(32-18-9-11-31-12-10-18)26-25(34-35)19-8-7-17(28)15-20(19)24(33-26)23-21(29)5-4-6-22(23)30/h4-8,15,18,31-32H,9-14,16H2,1-3H3 |
| InChIKey | NZMFNJFIKMEMKI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|