2-(4-chloro-2,3-dimethylphenyl)acetic acid

C10H11ClO2 — CID 66771246

IUPAC2-(4-chloro-2,3-dimethylphenyl)acetic acid
SMILESCc1c(Cl)ccc(CC(=O)O)c1C
InChIInChI=1S/C10H11ClO2/c1-6-7(2)9(11)4-3-8(6)5-10(12)13/h3-4H,5H2,1-2H3,(H,12,13)
InChIKeyHYFQWNUIOWIQEM-UHFFFAOYSA-N
MW198.65 g/mol
LogP2.58
Rot. Bonds2

About 2-(4-chloro-2,3-dimethylphenyl)acetic acid

2-(4-chloro-2,3-dimethylphenyl)acetic acid (PubChem CID 66771246) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-(4-chloro-2,3-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-(4-chloro-2,3-dimethylphenyl)acetic acid
PubChem CID66771246
Molecular FormulaC10H11ClO2
Molecular Weight198.65 g/mol
Exact Mass198.04
IUPAC Name2-(4-chloro-2,3-dimethylphenyl)acetic acid
SMILESCc1c(Cl)ccc(CC(=O)O)c1C
InChIInChI=1S/C10H11ClO2/c1-6-7(2)9(11)4-3-8(6)5-10(12)13/h3-4H,5H2,1-2H3,(H,12,13)
InChIKeyHYFQWNUIOWIQEM-UHFFFAOYSA-N
XLogP2.58
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.65
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(4-chloro-2,3-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chloro-2,3-dimethylphenyl)acetic acid?
The IUPAC name of 2-(4-chloro-2,3-dimethylphenyl)acetic acid (CID 66771246) is 2-(4-chloro-2,3-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-(4-chloro-2,3-dimethylphenyl)acetic acid?
The canonical SMILES for 2-(4-chloro-2,3-dimethylphenyl)acetic acid is Cc1c(Cl)ccc(CC(=O)O)c1C.
What is the InChIKey of 2-(4-chloro-2,3-dimethylphenyl)acetic acid?
The InChIKey is HYFQWNUIOWIQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c1-6-7(2)9(11)4-3-8(6)5-10(12)13/h3-4H,5H2,1-2H3,(H,12,13).
What are the key properties of 2-(4-chloro-2,3-dimethylphenyl)acetic acid?
2-(4-chloro-2,3-dimethylphenyl)acetic acid has a molecular weight of 198.65 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,3-dimethylphenyl)acetic acid is sourced from PubChem (CID 66771246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).