C12H16ClNO — CID 66771728
3,4,4a,5,6,6a-hexahydro-2H-benzo[h][1,4]benzoxazine;hydrochloride (PubChem CID 66771728) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 3,4,4a,5,6,6a-hexahydro-2H-benzo[h][1,4]benzoxazine;hydrochloride.
| Compound Name | 3,4,4a,5,6,6a-hexahydro-2H-benzo[h][1,4]benzoxazine;hydrochloride |
|---|---|
| PubChem CID | 66771728 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3,4,4a,5,6,6a-hexahydro-2H-benzo[h][1,4]benzoxazine;hydrochloride |
| SMILES | C1=CC2=C3OCCNC3CCC2C=C1.Cl |
| InChI | InChI=1S/C12H15NO.ClH/c1-2-4-10-9(3-1)5-6-11-12(10)14-8-7-13-11;/h1-4,9,11,13H,5-8H2;1H |
| InChIKey | XLAPUHJARHLGBA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |