C24H24N4O2S — CID 66771883
1-naphthalen-2-yl-3-[3-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 66771883) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-naphthalen-2-yl-3-[3-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-naphthalen-2-yl-3-[3-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 66771883 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-naphthalen-2-yl-3-[3-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CC(N2CCN(C(=O)c3nccs3)CC2)C1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H24N4O2S/c29-22(20-6-5-18-3-1-2-4-19(18)15-20)7-9-26-16-21(17-26)27-10-12-28(13-11-27)24(30)23-25-8-14-31-23/h1-9,14-15,21H,10-13,16-17H2 |
| InChIKey | SOJBFGQJJAYBLD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|