C27H33FN2O — CID 66771897
1-(3,6-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-yl)-1-(3-fluorophenyl)-N,N-dimethylmethanamine (PubChem CID 66771897) has the molecular formula C27H33FN2O and a molecular weight of 420.57 g/mol. Its IUPAC name is 1-(3,6-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-yl)-1-(3-fluorophenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(3,6-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-yl)-1-(3-fluorophenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 66771897 |
| Molecular Formula | C27H33FN2O |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 1-(3,6-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-yl)-1-(3-fluorophenyl)-N,N-dimethylmethanamine |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(C)OC31CCC(C(c2cccc(F)c2)N(C)C)CC1 |
| InChI | InChI=1S/C27H33FN2O/c1-17-8-9-24-22(14-17)23-15-18(2)31-27(26(23)29-24)12-10-19(11-13-27)25(30(3)4)20-6-5-7-21(28)16-20/h5-9,14,16,18-19,25,29H,10-13,15H2,1-4H3 |
| InChIKey | JLAFCZPDAFRZJE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |