About N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride
N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride (PubChem CID 66771972) has the molecular formula C10H19ClN6
and a molecular weight of 258.76 g/mol. Its IUPAC name is N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride |
| PubChem CID | 66771972 |
| Molecular Formula | C10H19ClN6 |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride |
| SMILES | CCN(CC)CC.Cl.c1cnc2n[nH]nc2n1 |
| InChI | InChI=1S/C6H15N.C4H3N5.ClH/c1-4-7(5-2)6-3;1-2-6-4-3(5-1)7-9-8-4;/h4-6H2,1-3H3;1-2H,(H,5,6,7,8,9);1H |
| InChIKey | BJMLXGJMWGCSQK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride?
The IUPAC name of N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride (CID 66771972) is N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride.
What is the SMILES notation for N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride?
The canonical SMILES for N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride is CCN(CC)CC.Cl.c1cnc2n[nH]nc2n1.
What is the InChIKey of N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride?
The InChIKey is BJMLXGJMWGCSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H3N5.ClH/c1-4-7(5-2)6-3;1-2-6-4-3(5-1)7-9-8-4;/h4-6H2,1-3H3;1-2H,(H,5,6,7,8,9);1H.
What are the key properties of N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride?
N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride has a molecular weight of 258.76 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;2H-triazolo[4,5-b]pyrazine;hydrochloride is sourced from PubChem (CID 66771972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).