About 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride
4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride (PubChem CID 66772391) has the molecular formula C21H23Cl3N4O
and a molecular weight of 453.80 g/mol. Its IUPAC name is 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride |
| PubChem CID | 66772391 |
| Molecular Formula | C21H23Cl3N4O |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride |
| SMILES | CCn1c(C(=O)Nc2ccc(N3CCNCC3)cc2)cc2c(Cl)c(Cl)ccc21.Cl |
| InChI | InChI=1S/C21H22Cl2N4O.ClH/c1-2-27-18-8-7-17(22)20(23)16(18)13-19(27)21(28)25-14-3-5-15(6-4-14)26-11-9-24-10-12-26;/h3-8,13,24H,2,9-12H2,1H3,(H,25,28);1H |
| InChIKey | JCKUAQDIMYYIFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride?
The IUPAC name of 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride (CID 66772391) is 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride.
What is the SMILES notation for 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride?
The canonical SMILES for 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride is CCn1c(C(=O)Nc2ccc(N3CCNCC3)cc2)cc2c(Cl)c(Cl)ccc21.Cl.
What is the InChIKey of 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride?
The InChIKey is JCKUAQDIMYYIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22Cl2N4O.ClH/c1-2-27-18-8-7-17(22)20(23)16(18)13-19(27)21(28)25-14-3-5-15(6-4-14)26-11-9-24-10-12-26;/h3-8,13,24H,2,9-12H2,1H3,(H,25,28);1H.
What are the key properties of 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride?
4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride has a molecular weight of 453.80 g/mol, XLogP of 5.05, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-1-ethyl-N-(4-piperazin-1-ylphenyl)indole-2-carboxamide;hydrochloride is sourced from PubChem (CID 66772391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).