C14H19NO3S — CID 66772462
methyl (2R)-4-methyl-2-(3-thiophen-3-ylprop-2-enoylamino)pentanoate (PubChem CID 66772462) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is methyl (2R)-4-methyl-2-(3-thiophen-3-ylprop-2-enoylamino)pentanoate.
| Compound Name | methyl (2R)-4-methyl-2-(3-thiophen-3-ylprop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 66772462 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | methyl (2R)-4-methyl-2-(3-thiophen-3-ylprop-2-enoylamino)pentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)C=Cc1ccsc1 |
| InChI | InChI=1S/C14H19NO3S/c1-10(2)8-12(14(17)18-3)15-13(16)5-4-11-6-7-19-9-11/h4-7,9-10,12H,8H2,1-3H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | QSPTWPRBVFTFJP-GFCCVEGCSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|