C10H35N5O5Si5 — CID 66773311
[4,6,8,10-tetrakis(aminomethyl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanamine (PubChem CID 66773311) has the molecular formula C10H35N5O5Si5 and a molecular weight of 445.85 g/mol. Its IUPAC name is [4,6,8,10-tetrakis(aminomethyl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanamine.
| Compound Name | [4,6,8,10-tetrakis(aminomethyl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanamine |
|---|---|
| PubChem CID | 66773311 |
| Molecular Formula | C10H35N5O5Si5 |
| Molecular Weight | 445.85 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [4,6,8,10-tetrakis(aminomethyl)-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanamine |
| SMILES | C[Si]1(CN)O[Si](C)(CN)O[Si](C)(CN)O[Si](C)(CN)O[Si](C)(CN)O1 |
| InChI | InChI=1S/C10H35N5O5Si5/c1-21(6-11)16-22(2,7-12)18-24(4,9-14)20-25(5,10-15)19-23(3,8-13)17-21/h6-15H2,1-5H3 |
| InChIKey | JSSLHOYUMRHYHW-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.85 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|