C24H37NO2 — CID 66773627
(6aR,9S,10aS)-3-(2-cyclohexylpropan-2-yl)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one (PubChem CID 66773627) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (6aR,9S,10aS)-3-(2-cyclohexylpropan-2-yl)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one.
| Compound Name | (6aR,9S,10aS)-3-(2-cyclohexylpropan-2-yl)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one |
|---|---|
| PubChem CID | 66773627 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (6aR,9S,10aS)-3-(2-cyclohexylpropan-2-yl)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one |
| SMILES | C[C@H]1CC[C@@H]2[C@H](C1)c1c([nH]c(C(C)(C)C3CCCCC3)cc1=O)OC2(C)C |
| InChI | InChI=1S/C24H37NO2/c1-15-11-12-18-17(13-15)21-19(26)14-20(25-22(21)27-24(18,4)5)23(2,3)16-9-7-6-8-10-16/h14-18H,6-13H2,1-5H3,(H,25,26)/t15-,17-,18+/m0/s1 |
| InChIKey | DYFHMLWLTCTNPS-RYQLBKOJSA-N |
| XLogP | 5.92 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |