About 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid
2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid (PubChem CID 66773650) has the molecular formula C32H31NO3
and a molecular weight of 477.60 g/mol. Its IUPAC name is 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid |
| PubChem CID | 66773650 |
| Molecular Formula | C32H31NO3 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid |
| SMILES | Cc1cc(C)cc(C(=O)N(CCCc2ccccc2)Cc2ccc(-c3ccccc3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C32H31NO3/c1-23-19-24(2)21-28(20-23)31(34)33(18-8-11-25-9-4-3-5-10-25)22-26-14-16-27(17-15-26)29-12-6-7-13-30(29)32(35)36/h3-7,9-10,12-17,19-21H,8,11,18,22H2,1-2H3,(H,35,36) |
| InChIKey | NCAMCIPTPPKVJE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid?
The IUPAC name of 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid (CID 66773650) is 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid.
What is the SMILES notation for 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid?
The canonical SMILES for 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid is Cc1cc(C)cc(C(=O)N(CCCc2ccccc2)Cc2ccc(-c3ccccc3C(=O)O)cc2)c1.
What is the InChIKey of 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid?
The InChIKey is NCAMCIPTPPKVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H31NO3/c1-23-19-24(2)21-28(20-23)31(34)33(18-8-11-25-9-4-3-5-10-25)22-26-14-16-27(17-15-26)29-12-6-7-13-30(29)32(35)36/h3-7,9-10,12-17,19-21H,8,11,18,22H2,1-2H3,(H,35,36).
What are the key properties of 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid?
2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid has a molecular weight of 477.60 g/mol, XLogP of 6.94, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[(3,5-dimethylbenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid is sourced from PubChem (CID 66773650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).