About 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline
3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline (PubChem CID 66773665) has the molecular formula C11H13ClF2N2
and a molecular weight of 246.69 g/mol. Its IUPAC name is 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline.
Molecular Properties
| Compound Name | 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline |
| PubChem CID | 66773665 |
| Molecular Formula | C11H13ClF2N2 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline |
| SMILES | FC1(F)CN[C@H](CNc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C11H13ClF2N2/c12-8-2-1-3-9(4-8)15-6-10-5-11(13,14)7-16-10/h1-4,10,15-16H,5-7H2/t10-/m0/s1 |
| InChIKey | XTIKGXVNBXNJNP-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline?
The IUPAC name of 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline (CID 66773665) is 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline.
What is the SMILES notation for 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline?
The canonical SMILES for 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline is FC1(F)CN[C@H](CNc2cccc(Cl)c2)C1.
What is the InChIKey of 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline?
The InChIKey is XTIKGXVNBXNJNP-JTQLQIEISA-N. The full InChI is InChI=1S/C11H13ClF2N2/c12-8-2-1-3-9(4-8)15-6-10-5-11(13,14)7-16-10/h1-4,10,15-16H,5-7H2/t10-/m0/s1.
What are the key properties of 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline?
3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline has a molecular weight of 246.69 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[[(2S)-4,4-difluoropyrrolidin-2-yl]methyl]aniline is sourced from PubChem (CID 66773665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).