About 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole
2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole (PubChem CID 66773708) has the molecular formula C21H24N2O2S
and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole.
Molecular Properties
| Compound Name | 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole |
| PubChem CID | 66773708 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole |
| SMILES | Cc1cccc([C@H](C)c2nccn2Cc2ccc(S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C21H24N2O2S/c1-15-6-5-7-20(16(15)2)17(3)21-22-12-13-23(21)14-18-8-10-19(11-9-18)26(4,24)25/h5-13,17H,14H2,1-4H3/t17-/m0/s1 |
| InChIKey | HQUKZPSOUZYBFL-KRWDZBQOSA-N |
| XLogP | 4.10 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole?
The IUPAC name of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole (CID 66773708) is 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole.
What is the SMILES notation for 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole?
The canonical SMILES for 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole is Cc1cccc([C@H](C)c2nccn2Cc2ccc(S(C)(=O)=O)cc2)c1C.
What is the InChIKey of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole?
The InChIKey is HQUKZPSOUZYBFL-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H24N2O2S/c1-15-6-5-7-20(16(15)2)17(3)21-22-12-13-23(21)14-18-8-10-19(11-9-18)26(4,24)25/h5-13,17H,14H2,1-4H3/t17-/m0/s1.
What are the key properties of 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole?
2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole has a molecular weight of 368.50 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-[(4-methylsulfonylphenyl)methyl]imidazole is sourced from PubChem (CID 66773708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).