About CID 66773741
CID 66773741 (PubChem CID 66773741) has the molecular formula C10H13FSi
and a molecular weight of 180.30 g/mol.
Molecular Properties
| Compound Name | CID 66773741 |
| PubChem CID | 66773741 |
| Molecular Formula | C10H13FSi |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | — |
| SMILES | CCc1cccc([Si]F)c1CC |
| InChI | InChI=1S/C10H13FSi/c1-3-8-6-5-7-10(12-11)9(8)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | HCPBBEHXQVSNNJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 66773741 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66773741?
The IUPAC name of CID 66773741 (CID 66773741) is not available.
What is the SMILES notation for CID 66773741?
The canonical SMILES for CID 66773741 is CCc1cccc([Si]F)c1CC.
What is the InChIKey of CID 66773741?
The InChIKey is HCPBBEHXQVSNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FSi/c1-3-8-6-5-7-10(12-11)9(8)4-2/h5-7H,3-4H2,1-2H3.
What are the key properties of CID 66773741?
CID 66773741 has a molecular weight of 180.30 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66773741 is sourced from PubChem (CID 66773741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).