About 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid
3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid (PubChem CID 66774424) has the molecular formula C34H35NO5
and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid |
| PubChem CID | 66774424 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid |
| SMILES | COc1cc(OC)cc(C(=O)N(CCCc2ccccc2)Cc2ccc(-c3ccccc3CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C34H35NO5/c1-39-30-21-29(22-31(23-30)40-2)34(38)35(20-8-11-25-9-4-3-5-10-25)24-26-14-16-28(17-15-26)32-13-7-6-12-27(32)18-19-33(36)37/h3-7,9-10,12-17,21-23H,8,11,18-20,24H2,1-2H3,(H,36,37) |
| InChIKey | MRAYZONGBXTQKB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid?
The IUPAC name of 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid (CID 66774424) is 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid.
What is the SMILES notation for 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid?
The canonical SMILES for 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid is COc1cc(OC)cc(C(=O)N(CCCc2ccccc2)Cc2ccc(-c3ccccc3CCC(=O)O)cc2)c1.
What is the InChIKey of 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid?
The InChIKey is MRAYZONGBXTQKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H35NO5/c1-39-30-21-29(22-31(23-30)40-2)34(38)35(20-8-11-25-9-4-3-5-10-25)24-26-14-16-28(17-15-26)32-13-7-6-12-27(32)18-19-33(36)37/h3-7,9-10,12-17,21-23H,8,11,18-20,24H2,1-2H3,(H,36,37).
What are the key properties of 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid?
3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid has a molecular weight of 537.66 g/mol, XLogP of 6.66, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenyl]phenyl]propanoic acid is sourced from PubChem (CID 66774424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).