C13H9N3S — CID 66774546
5-(2-pyridin-2-ylethenyl)-2,1,3-benzothiadiazole (PubChem CID 66774546) has the molecular formula C13H9N3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 5-(2-pyridin-2-ylethenyl)-2,1,3-benzothiadiazole.
| Compound Name | 5-(2-pyridin-2-ylethenyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 66774546 |
| Molecular Formula | C13H9N3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-(2-pyridin-2-ylethenyl)-2,1,3-benzothiadiazole |
| SMILES | C(=Cc1ccccn1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C13H9N3S/c1-2-8-14-11(3-1)6-4-10-5-7-12-13(9-10)16-17-15-12/h1-9H |
| InChIKey | IVOSPBPENWAQPB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |