About N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine
N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine (PubChem CID 66776214) has the molecular formula C14H25F3N2
and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine.
Molecular Properties
| Compound Name | N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine |
| PubChem CID | 66776214 |
| Molecular Formula | C14H25F3N2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine |
| SMILES | CCCCCNCC1C2CN(CCC(F)(F)F)CC12 |
| InChI | InChI=1S/C14H25F3N2/c1-2-3-4-6-18-8-11-12-9-19(10-13(11)12)7-5-14(15,16)17/h11-13,18H,2-10H2,1H3 |
| InChIKey | AJYHZVUEZYHHIP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine?
The IUPAC name of N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine (CID 66776214) is N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine.
What is the SMILES notation for N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine?
The canonical SMILES for N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine is CCCCCNCC1C2CN(CCC(F)(F)F)CC12.
What is the InChIKey of N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine?
The InChIKey is AJYHZVUEZYHHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F3N2/c1-2-3-4-6-18-8-11-12-9-19(10-13(11)12)7-5-14(15,16)17/h11-13,18H,2-10H2,1H3.
What are the key properties of N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine?
N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine has a molecular weight of 278.36 g/mol, XLogP of 2.90, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]pentan-1-amine is sourced from PubChem (CID 66776214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).