About iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide
iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide (PubChem CID 66776538) has the molecular formula C15H22BBrFeN6
and a molecular weight of 432.94 g/mol. Its IUPAC name is iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide.
Molecular Properties
| Compound Name | iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide |
| PubChem CID | 66776538 |
| Molecular Formula | C15H22BBrFeN6 |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide |
| SMILES | Br.Cc1n[nH]c(C)c1B(c1c(C)n[nH]c1C)c1c(C)n[nH]c1C.[Fe] |
| InChI | InChI=1S/C15H21BN6.BrH.Fe/c1-7-13(8(2)18-17-7)16(14-9(3)19-20-10(14)4)15-11(5)21-22-12(15)6;;/h1-6H3,(H,17,18)(H,19,20)(H,21,22);1H; |
| InChIKey | HYGCXIZPFGKQOU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide?
The IUPAC name of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide (CID 66776538) is iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide.
What is the SMILES notation for iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide?
The canonical SMILES for iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide is Br.Cc1n[nH]c(C)c1B(c1c(C)n[nH]c1C)c1c(C)n[nH]c1C.[Fe].
What is the InChIKey of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide?
The InChIKey is HYGCXIZPFGKQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BN6.BrH.Fe/c1-7-13(8(2)18-17-7)16(14-9(3)19-20-10(14)4)15-11(5)21-22-12(15)6;;/h1-6H3,(H,17,18)(H,19,20)(H,21,22);1H;.
What are the key properties of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide?
iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide has a molecular weight of 432.94 g/mol, XLogP of 0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrobromide is sourced from PubChem (CID 66776538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).