About iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride
iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride (PubChem CID 66776697) has the molecular formula C33H58BClFeN6
and a molecular weight of 640.98 g/mol. Its IUPAC name is iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride.
Molecular Properties
| Compound Name | iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride |
| PubChem CID | 66776697 |
| Molecular Formula | C33H58BClFeN6 |
| Molecular Weight | 640.98 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride |
| SMILES | CC(C)(C)c1n[nH]c(C(C)(C)C)c1B(c1c(C(C)(C)C)n[nH]c1C(C)(C)C)c1c(C(C)(C)C)n[nH]c1C(C)(C)C.Cl.[Fe] |
| InChI | InChI=1S/C33H57BN6.ClH.Fe/c1-28(2,3)22-19(23(36-35-22)29(4,5)6)34(20-24(30(7,8)9)37-38-25(20)31(10,11)12)21-26(32(13,14)15)39-40-27(21)33(16,17)18;;/h1-18H3,(H,35,36)(H,37,38)(H,39,40);1H; |
| InChIKey | GNRKHLNERFYDPN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.98 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride?
The IUPAC name of iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride (CID 66776697) is iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride.
What is the SMILES notation for iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride?
The canonical SMILES for iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride is CC(C)(C)c1n[nH]c(C(C)(C)C)c1B(c1c(C(C)(C)C)n[nH]c1C(C)(C)C)c1c(C(C)(C)C)n[nH]c1C(C)(C)C.Cl.[Fe].
What is the InChIKey of iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride?
The InChIKey is GNRKHLNERFYDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H57BN6.ClH.Fe/c1-28(2,3)22-19(23(36-35-22)29(4,5)6)34(20-24(30(7,8)9)37-38-25(20)31(10,11)12)21-26(32(13,14)15)39-40-27(21)33(16,17)18;;/h1-18H3,(H,35,36)(H,37,38)(H,39,40);1H;.
What are the key properties of iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride?
iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride has a molecular weight of 640.98 g/mol, XLogP of 6.58, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;tris(3,5-ditert-butyl-1H-pyrazol-4-yl)borane;hydrochloride is sourced from PubChem (CID 66776697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).