C31H44N2O4 — CID 66776779
[10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,4-diazocane-1-carboxylate (PubChem CID 66776779) has the molecular formula C31H44N2O4 and a molecular weight of 508.70 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,4-diazocane-1-carboxylate.
| Compound Name | [10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,4-diazocane-1-carboxylate |
|---|---|
| PubChem CID | 66776779 |
| Molecular Formula | C31H44N2O4 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | [10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,4-diazocane-1-carboxylate |
| SMILES | CC12CCC3C(CCC4CC(OC(=O)N5CCCCNCC5)CCC43C)C1=CCC2c1ccc(=O)oc1 |
| InChI | InChI=1S/C31H44N2O4/c1-30-13-11-23(37-29(35)33-17-4-3-15-32-16-18-33)19-22(30)6-7-24-26-9-8-25(21-5-10-28(34)36-20-21)31(26,2)14-12-27(24)30/h5,9-10,20,22-25,27,32H,3-4,6-8,11-19H2,1-2H3 |
| InChIKey | FZHNRZGNENCHFO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|