C26H27N7O — CID 66776889
2-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-[[(1R,4R)-1,4,5-trimethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1,3,4-oxadiazole (PubChem CID 66776889) has the molecular formula C26H27N7O and a molecular weight of 453.55 g/mol. Its IUPAC name is 2-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-[[(1R,4R)-1,4,5-trimethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-[[(1R,4R)-1,4,5-trimethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 66776889 |
| Molecular Formula | C26H27N7O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-[[(1R,4R)-1,4,5-trimethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1,3,4-oxadiazole |
| SMILES | CN1C[C@@]2(C)C[C@]1(C)CN2Cc1nnc(-c2cc(-c3cccc4[nH]ccc34)cc3[nH]ncc23)o1 |
| InChI | InChI=1S/C26H27N7O/c1-25-13-26(2,14-32(25)3)33(15-25)12-23-30-31-24(34-23)19-9-16(10-22-20(19)11-28-29-22)17-5-4-6-21-18(17)7-8-27-21/h4-11,27H,12-15H2,1-3H3,(H,28,29)/t25-,26-/m1/s1 |
| InChIKey | OPMKSNQGIAFHBB-CLJLJLNGSA-N |
| XLogP | 4.43 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |