C16H20OS — CID 66777138
cyclohexyl-(2-methyl-1-benzothiophen-3-yl)methanol (PubChem CID 66777138) has the molecular formula C16H20OS and a molecular weight of 260.40 g/mol. Its IUPAC name is cyclohexyl-(2-methyl-1-benzothiophen-3-yl)methanol.
| Compound Name | cyclohexyl-(2-methyl-1-benzothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 66777138 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | cyclohexyl-(2-methyl-1-benzothiophen-3-yl)methanol |
| SMILES | Cc1sc2ccccc2c1C(O)C1CCCCC1 |
| InChI | InChI=1S/C16H20OS/c1-11-15(13-9-5-6-10-14(13)18-11)16(17)12-7-3-2-4-8-12/h5-6,9-10,12,16-17H,2-4,7-8H2,1H3 |
| InChIKey | UPDUEOAEKCOADZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |