About iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride
iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride (PubChem CID 66777177) has the molecular formula C15H22BClFeN6
and a molecular weight of 388.49 g/mol. Its IUPAC name is iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride.
Molecular Properties
| Compound Name | iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride |
| PubChem CID | 66777177 |
| Molecular Formula | C15H22BClFeN6 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1B(c1c(C)n[nH]c1C)c1c(C)n[nH]c1C.Cl.[Fe] |
| InChI | InChI=1S/C15H21BN6.ClH.Fe/c1-7-13(8(2)18-17-7)16(14-9(3)19-20-10(14)4)15-11(5)21-22-12(15)6;;/h1-6H3,(H,17,18)(H,19,20)(H,21,22);1H; |
| InChIKey | VHQOBMONWPLCRV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride?
The IUPAC name of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride (CID 66777177) is iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride.
What is the SMILES notation for iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride?
The canonical SMILES for iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride is Cc1n[nH]c(C)c1B(c1c(C)n[nH]c1C)c1c(C)n[nH]c1C.Cl.[Fe].
What is the InChIKey of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride?
The InChIKey is VHQOBMONWPLCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BN6.ClH.Fe/c1-7-13(8(2)18-17-7)16(14-9(3)19-20-10(14)4)15-11(5)21-22-12(15)6;;/h1-6H3,(H,17,18)(H,19,20)(H,21,22);1H;.
What are the key properties of iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride?
iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride has a molecular weight of 388.49 g/mol, XLogP of 0.64, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;tris(3,5-dimethyl-1H-pyrazol-4-yl)borane;hydrochloride is sourced from PubChem (CID 66777177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).