C18H20ClN7O2S — CID 66777217
6-[1-[8-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)quinolin-3-yl]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 66777217) has the molecular formula C18H20ClN7O2S and a molecular weight of 433.93 g/mol. Its IUPAC name is 6-[1-[8-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)quinolin-3-yl]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[8-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)quinolin-3-yl]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66777217 |
| Molecular Formula | C18H20ClN7O2S |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 6-[1-[8-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)quinolin-3-yl]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(c1nc(N)nc(N)n1)c1cc2cccc(Cl)c2nc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H20ClN7O2S/c1-10(15-23-17(20)25-18(21)24-15)12-9-11-3-2-4-13(19)14(11)22-16(12)26-5-7-29(27,28)8-6-26/h2-4,9-10H,5-8H2,1H3,(H4,20,21,23,24,25) |
| InChIKey | FSKSFVCNIRUGJF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |