About cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone
cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 66777401) has the molecular formula C16H16F2O2
and a molecular weight of 278.30 g/mol. Its IUPAC name is cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone |
| PubChem CID | 66777401 |
| Molecular Formula | C16H16F2O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)C2CCCCC2)oc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C16H16F2O2/c1-9-12-7-11(17)8-13(18)16(12)20-15(9)14(19)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | QZFLPVKTFJVNEU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone?
The IUPAC name of cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone (CID 66777401) is cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone.
What is the SMILES notation for cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone?
The canonical SMILES for cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone is Cc1c(C(=O)C2CCCCC2)oc2c(F)cc(F)cc12.
What is the InChIKey of cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone?
The InChIKey is QZFLPVKTFJVNEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2O2/c1-9-12-7-11(17)8-13(18)16(12)20-15(9)14(19)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3.
What are the key properties of cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone?
cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone has a molecular weight of 278.30 g/mol, XLogP of 4.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 66777401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).