About 1,2,3-benzothiadiazole;1,3-benzothiazole
1,2,3-benzothiadiazole;1,3-benzothiazole (PubChem CID 66777460) has the molecular formula C13H9N3S2
and a molecular weight of 271.37 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole;1,3-benzothiazole.
Molecular Properties
| Compound Name | 1,2,3-benzothiadiazole;1,3-benzothiazole |
| PubChem CID | 66777460 |
| Molecular Formula | C13H9N3S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1,2,3-benzothiadiazole;1,3-benzothiazole |
| SMILES | c1ccc2scnc2c1.c1ccc2snnc2c1 |
| InChI | InChI=1S/C7H5NS.C6H4N2S/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5(3-1)7-8-9-6/h1-5H;1-4H |
| InChIKey | YHXMIHSQFJZKQK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2,3-benzothiadiazole;1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-benzothiadiazole;1,3-benzothiazole?
The IUPAC name of 1,2,3-benzothiadiazole;1,3-benzothiazole (CID 66777460) is 1,2,3-benzothiadiazole;1,3-benzothiazole.
What is the SMILES notation for 1,2,3-benzothiadiazole;1,3-benzothiazole?
The canonical SMILES for 1,2,3-benzothiadiazole;1,3-benzothiazole is c1ccc2scnc2c1.c1ccc2snnc2c1.
What is the InChIKey of 1,2,3-benzothiadiazole;1,3-benzothiazole?
The InChIKey is YHXMIHSQFJZKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C6H4N2S/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5(3-1)7-8-9-6/h1-5H;1-4H.
What are the key properties of 1,2,3-benzothiadiazole;1,3-benzothiazole?
1,2,3-benzothiadiazole;1,3-benzothiazole has a molecular weight of 271.37 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzothiadiazole;1,3-benzothiazole is sourced from PubChem (CID 66777460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).