About 1,3-dioxol-2-one;ethenyl acetate
1,3-dioxol-2-one;ethenyl acetate (PubChem CID 66777759) has the molecular formula C7H8O5
and a molecular weight of 172.14 g/mol. Its IUPAC name is 1,3-dioxol-2-one;ethenyl acetate.
Molecular Properties
| Compound Name | 1,3-dioxol-2-one;ethenyl acetate |
| PubChem CID | 66777759 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 1,3-dioxol-2-one;ethenyl acetate |
| SMILES | C=COC(C)=O.O=c1occo1 |
| InChI | InChI=1S/C4H6O2.C3H2O3/c1-3-6-4(2)5;4-3-5-1-2-6-3/h3H,1H2,2H3;1-2H |
| InChIKey | GOCCKXAJVOKYJF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxol-2-one;ethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxol-2-one;ethenyl acetate?
The IUPAC name of 1,3-dioxol-2-one;ethenyl acetate (CID 66777759) is 1,3-dioxol-2-one;ethenyl acetate.
What is the SMILES notation for 1,3-dioxol-2-one;ethenyl acetate?
The canonical SMILES for 1,3-dioxol-2-one;ethenyl acetate is C=COC(C)=O.O=c1occo1.
What is the InChIKey of 1,3-dioxol-2-one;ethenyl acetate?
The InChIKey is GOCCKXAJVOKYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H2O3/c1-3-6-4(2)5;4-3-5-1-2-6-3/h3H,1H2,2H3;1-2H.
What are the key properties of 1,3-dioxol-2-one;ethenyl acetate?
1,3-dioxol-2-one;ethenyl acetate has a molecular weight of 172.14 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxol-2-one;ethenyl acetate is sourced from PubChem (CID 66777759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).