C16H19FO2 — CID 66777937
cyclohexyl-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanol (PubChem CID 66777937) has the molecular formula C16H19FO2 and a molecular weight of 262.32 g/mol. Its IUPAC name is cyclohexyl-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanol.
| Compound Name | cyclohexyl-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 66777937 |
| Molecular Formula | C16H19FO2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | cyclohexyl-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanol |
| SMILES | Cc1c(C(O)C2CCCCC2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C16H19FO2/c1-10-13-9-12(17)7-8-14(13)19-16(10)15(18)11-5-3-2-4-6-11/h7-9,11,15,18H,2-6H2,1H3 |
| InChIKey | OFHDVGJKXNMDBB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |