C28H23NO5 — CID 66779376
7-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]furo[3,2-b]pyridine (PubChem CID 66779376) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is 7-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]furo[3,2-b]pyridine.
| Compound Name | 7-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 66779376 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 7-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]furo[3,2-b]pyridine |
| SMILES | C1=CCCC(CC2=COC=C(c3cc4nccc(C5=COC=C(C6=CC=CCC6)O5)c4o3)O2)=C1 |
| InChI | InChI=1S/C28H23NO5/c1-3-7-19(8-4-1)13-21-15-30-18-27(32-21)24-14-23-28(34-24)22(11-12-29-23)26-17-31-16-25(33-26)20-9-5-2-6-10-20/h1-3,5,7,9,11-12,14-18H,4,6,8,10,13H2 |
| InChIKey | JUSGZGHBAAZHEF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |