About methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate
methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate (PubChem CID 667794) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate.
Molecular Properties
| Compound Name | methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate |
| PubChem CID | 667794 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate |
| SMILES | COC(=O)CCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H10N2O3S/c1-13-7(12)3-2-6(11)10-8-9-4-5-14-8/h4-5H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | JDWOYXXSBRCZBU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate?
The IUPAC name of methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate (CID 667794) is methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate.
What is the SMILES notation for methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate?
The canonical SMILES for methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate is COC(=O)CCC(=O)Nc1nccs1.
What is the InChIKey of methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate?
The InChIKey is JDWOYXXSBRCZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-13-7(12)3-2-6(11)10-8-9-4-5-14-8/h4-5H,2-3H2,1H3,(H,9,10,11).
What are the key properties of methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate?
methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate has a molecular weight of 214.25 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-4-(1,3-thiazol-2-ylamino)butanoate is sourced from PubChem (CID 667794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).